C19H29NO3Si — CID 15438068
1-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]piperidine-2,3-dione (PubChem CID 15438068) has the molecular formula C19H29NO3Si and a molecular weight of 347.53 g/mol. Its IUPAC name is 1-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]piperidine-2,3-dione.
| Compound Name | 1-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]piperidine-2,3-dione |
|---|---|
| PubChem CID | 15438068 |
| Molecular Formula | C19H29NO3Si |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 1-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]piperidine-2,3-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](c1ccccc1)N1CCCC(=O)C1=O |
| InChI | InChI=1S/C19H29NO3Si/c1-19(2,3)24(4,5)23-14-16(15-10-7-6-8-11-15)20-13-9-12-17(21)18(20)22/h6-8,10-11,16H,9,12-14H2,1-5H3/t16-/m0/s1 |
| InChIKey | KHJQUIQBTSCTSD-INIZCTEOSA-N |
| XLogP | 3.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|