C14H23F2NO2SSi — CID 153432727
tert-butyl-[(2R)-2-[[difluoro(oxo)-λ6-sulfanylidene]amino]-2-phenylethoxy]-dimethylsilane (PubChem CID 153432727) has the molecular formula C14H23F2NO2SSi and a molecular weight of 335.49 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-[[difluoro(oxo)-λ6-sulfanylidene]amino]-2-phenylethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-2-[[difluoro(oxo)-λ6-sulfanylidene]amino]-2-phenylethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 153432727 |
| Molecular Formula | C14H23F2NO2SSi |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | tert-butyl-[(2R)-2-[[difluoro(oxo)-λ6-sulfanylidene]amino]-2-phenylethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](N=S(=O)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H23F2NO2SSi/c1-14(2,3)21(4,5)19-11-13(17-20(15,16)18)12-9-7-6-8-10-12/h6-10,13H,11H2,1-5H3/t13-/m0/s1 |
| InChIKey | XZZVQQBUEYAXAB-ZDUSSCGKSA-N |
| XLogP | 4.99 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|