C15H24F3NO3SSi — CID 166446319
N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 166446319) has the molecular formula C15H24F3NO3SSi and a molecular weight of 383.51 g/mol. Its IUPAC name is N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 166446319 |
| Molecular Formula | C15H24F3NO3SSi |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](NS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H24F3NO3SSi/c1-14(2,3)24(4,5)22-11-13(12-9-7-6-8-10-12)19-23(20,21)15(16,17)18/h6-10,13,19H,11H2,1-5H3/t13-/m0/s1 |
| InChIKey | WGGRIUJDKPLZNX-ZDUSSCGKSA-N |
| XLogP | 4.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|