C18H32FNO2SSi — CID 135005494
(R)-N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 135005494) has the molecular formula C18H32FNO2SSi and a molecular weight of 373.61 g/mol. Its IUPAC name is (R)-N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 135005494 |
| Molecular Formula | C18H32FNO2SSi |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (R)-N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@@H](CO[Si](C)(C)C(C)(C)C)c1ccccc1F |
| InChI | InChI=1S/C18H32FNO2SSi/c1-17(2,3)23(21)20-16(14-11-9-10-12-15(14)19)13-22-24(7,8)18(4,5)6/h9-12,16,20H,13H2,1-8H3/t16-,23+/m0/s1 |
| InChIKey | NYQVYLLCTWYPFZ-QMHKHESXSA-N |
| XLogP | 4.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|