C18H31F2NO2SSi — CID 67033077
N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2,4-difluorophenyl)ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 67033077) has the molecular formula C18H31F2NO2SSi and a molecular weight of 391.60 g/mol. Its IUPAC name is N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2,4-difluorophenyl)ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2,4-difluorophenyl)ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 67033077 |
| Molecular Formula | C18H31F2NO2SSi |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2,4-difluorophenyl)ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N[C@@H](CO[Si](C)(C)C(C)(C)C)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H31F2NO2SSi/c1-17(2,3)24(22)21-16(12-23-25(7,8)18(4,5)6)14-10-9-13(19)11-15(14)20/h9-11,16,21H,12H2,1-8H3/t16-,24?/m0/s1 |
| InChIKey | JCQZKXOCNGXKTJ-FXIRQEPWSA-N |
| XLogP | 5.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|