C30H39NO2Si — CID 11225260
(2S)-1-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-diphenylethyl]-2-methyl-2,6,7,8-tetrahydroquinolin-5-one (PubChem CID 11225260) has the molecular formula C30H39NO2Si and a molecular weight of 473.73 g/mol. Its IUPAC name is (2S)-1-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-diphenylethyl]-2-methyl-2,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (2S)-1-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-diphenylethyl]-2-methyl-2,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 11225260 |
| Molecular Formula | C30H39NO2Si |
| Molecular Weight | 473.73 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | (2S)-1-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-diphenylethyl]-2-methyl-2,6,7,8-tetrahydroquinolin-5-one |
| SMILES | C[C@H]1C=CC2=C(CCCC2=O)N1[C@@H](c1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C30H39NO2Si/c1-22-20-21-25-26(18-13-19-27(25)32)31(22)28(23-14-9-7-10-15-23)29(24-16-11-8-12-17-24)33-34(5,6)30(2,3)4/h7-12,14-17,20-22,28-29H,13,18-19H2,1-6H3/t22-,28-,29+/m0/s1 |
| InChIKey | RBOVFCUWAVWSMZ-PWUSVURUSA-N |
| XLogP | 7.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.73 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|