C16H25IO3Si — CID 101058380
methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-iodo-3-phenylpropanoate (PubChem CID 101058380) has the molecular formula C16H25IO3Si and a molecular weight of 420.36 g/mol. Its IUPAC name is methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-iodo-3-phenylpropanoate.
| Compound Name | methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-iodo-3-phenylpropanoate |
|---|---|
| PubChem CID | 101058380 |
| Molecular Formula | C16H25IO3Si |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-iodo-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](I)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H25IO3Si/c1-16(2,3)21(5,6)20-14(13(17)15(18)19-4)12-10-8-7-9-11-12/h7-11,13-14H,1-6H3/t13-,14-/m0/s1 |
| InChIKey | ULRVENPXVDILRZ-KBPBESRZSA-N |
| XLogP | 4.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|