C19H30O4Si — CID 11046348
methyl (2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-oxo-3-phenylpentanoate (PubChem CID 11046348) has the molecular formula C19H30O4Si and a molecular weight of 350.53 g/mol. Its IUPAC name is methyl (2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-oxo-3-phenylpentanoate.
| Compound Name | methyl (2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-oxo-3-phenylpentanoate |
|---|---|
| PubChem CID | 11046348 |
| Molecular Formula | C19H30O4Si |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | methyl (2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-oxo-3-phenylpentanoate |
| SMILES | COC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](c1ccccc1)[C@@H](C)C=O |
| InChI | InChI=1S/C19H30O4Si/c1-14(13-20)16(15-11-9-8-10-12-15)17(18(21)22-5)23-24(6,7)19(2,3)4/h8-14,16-17H,1-7H3/t14-,16+,17-/m0/s1 |
| InChIKey | CJRUBRVEBSPOKG-UAGQMJEPSA-N |
| XLogP | 4.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|