C19H30O4Si — CID 24755019
phenyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methylpent-4-enoate (PubChem CID 24755019) has the molecular formula C19H30O4Si and a molecular weight of 350.53 g/mol. Its IUPAC name is phenyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methylpent-4-enoate.
| Compound Name | phenyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methylpent-4-enoate |
|---|---|
| PubChem CID | 24755019 |
| Molecular Formula | C19H30O4Si |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | phenyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methylpent-4-enoate |
| SMILES | C=C(C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](OC)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C19H30O4Si/c1-14(2)16(23-24(7,8)19(3,4)5)17(21-6)18(20)22-15-12-10-9-11-13-15/h9-13,16-17H,1H2,2-8H3/t16-,17+/m0/s1 |
| InChIKey | WBBJXNUVISJDNF-DLBZAZTESA-N |
| XLogP | 4.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|