C21H34O5Si2 — CID 10862764
(4-methoxyphenyl) (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-trimethylsilylpent-4-ynoate (PubChem CID 10862764) has the molecular formula C21H34O5Si2 and a molecular weight of 422.67 g/mol. Its IUPAC name is (4-methoxyphenyl) (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-trimethylsilylpent-4-ynoate.
| Compound Name | (4-methoxyphenyl) (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-trimethylsilylpent-4-ynoate |
|---|---|
| PubChem CID | 10862764 |
| Molecular Formula | C21H34O5Si2 |
| Molecular Weight | 422.67 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (4-methoxyphenyl) (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-trimethylsilylpent-4-ynoate |
| SMILES | COc1ccc(OC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)C#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C21H34O5Si2/c1-21(2,3)28(8,9)26-19(18(22)14-15-27(5,6)7)20(23)25-17-12-10-16(24-4)11-13-17/h10-13,18-19,22H,1-9H3/t18-,19-/m1/s1 |
| InChIKey | CTUIINNKYKDOGU-RTBURBONSA-N |
| XLogP | 4.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.67 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|