C28H43NO4Si — CID 11785030
(2,4,6-trimethylphenyl) (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyanilino)-4-methylpentanoate (PubChem CID 11785030) has the molecular formula C28H43NO4Si and a molecular weight of 485.74 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyanilino)-4-methylpentanoate.
| Compound Name | (2,4,6-trimethylphenyl) (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyanilino)-4-methylpentanoate |
|---|---|
| PubChem CID | 11785030 |
| Molecular Formula | C28H43NO4Si |
| Molecular Weight | 485.74 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | (2,4,6-trimethylphenyl) (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyanilino)-4-methylpentanoate |
| SMILES | COc1ccc(N[C@H](C(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)Oc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C28H43NO4Si/c1-18(2)24(29-22-12-14-23(31-9)15-13-22)26(33-34(10,11)28(6,7)8)27(30)32-25-20(4)16-19(3)17-21(25)5/h12-18,24,26,29H,1-11H3/t24-,26-/m1/s1 |
| InChIKey | SKSGAYRERQYXON-AOYPEHQESA-N |
| XLogP | 7.05 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.74 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|