C28H37NO6SSi — CID 122404650
methyl (2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyanilino)-3-[3-(4-methylphenyl)sulfinylfuran-2-yl]propanoate (PubChem CID 122404650) has the molecular formula C28H37NO6SSi and a molecular weight of 543.76 g/mol. Its IUPAC name is methyl (2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyanilino)-3-[3-(4-methylphenyl)sulfinylfuran-2-yl]propanoate.
| Compound Name | methyl (2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyanilino)-3-[3-(4-methylphenyl)sulfinylfuran-2-yl]propanoate |
|---|---|
| PubChem CID | 122404650 |
| Molecular Formula | C28H37NO6SSi |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | methyl (2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyanilino)-3-[3-(4-methylphenyl)sulfinylfuran-2-yl]propanoate |
| SMILES | COC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](Nc1ccc(OC)cc1)c1occc1S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H37NO6SSi/c1-19-9-15-22(16-10-19)36(31)23-17-18-34-25(23)24(29-20-11-13-21(32-5)14-12-20)26(27(30)33-6)35-37(7,8)28(2,3)4/h9-18,24,26,29H,1-8H3/t24-,26-,36?/m0/s1 |
| InChIKey | KSXCRFQCRKOGJC-CXNHNNRNSA-N |
| XLogP | 6.48 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|