C19H36N2O4Si — CID 23652376
(2R,3R,4R)-5-amino-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-(4-methoxyanilino)pentan-1-ol (PubChem CID 23652376) has the molecular formula C19H36N2O4Si and a molecular weight of 384.59 g/mol. Its IUPAC name is (2R,3R,4R)-5-amino-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-(4-methoxyanilino)pentan-1-ol.
| Compound Name | (2R,3R,4R)-5-amino-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-(4-methoxyanilino)pentan-1-ol |
|---|---|
| PubChem CID | 23652376 |
| Molecular Formula | C19H36N2O4Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | (2R,3R,4R)-5-amino-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-(4-methoxyanilino)pentan-1-ol |
| SMILES | COc1ccc(N[C@H]([C@H](CO)OC)[C@@H](CN)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H36N2O4Si/c1-19(2,3)26(6,7)25-16(12-20)18(17(13-22)24-5)21-14-8-10-15(23-4)11-9-14/h8-11,16-18,21-22H,12-13,20H2,1-7H3/t16-,17+,18+/m1/s1 |
| InChIKey | IJDYDRNVIYJUDR-SQNIBIBYSA-N |
| XLogP | 2.83 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|