C25H36N2O4Si — CID 23650289
(2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-(4-methoxyanilino)-4-phenylmethoxypentanenitrile (PubChem CID 23650289) has the molecular formula C25H36N2O4Si and a molecular weight of 456.66 g/mol. Its IUPAC name is (2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-(4-methoxyanilino)-4-phenylmethoxypentanenitrile.
| Compound Name | (2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-(4-methoxyanilino)-4-phenylmethoxypentanenitrile |
|---|---|
| PubChem CID | 23650289 |
| Molecular Formula | C25H36N2O4Si |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3-(4-methoxyanilino)-4-phenylmethoxypentanenitrile |
| SMILES | COc1ccc(N[C@H]([C@H](CO)OCc2ccccc2)[C@@H](C#N)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H36N2O4Si/c1-25(2,3)32(5,6)31-22(16-26)24(27-20-12-14-21(29-4)15-13-20)23(17-28)30-18-19-10-8-7-9-11-19/h7-15,22-24,27-28H,17-18H2,1-6H3/t22-,23+,24+/m1/s1 |
| InChIKey | LWVXAAXWVZHPKW-SGNDLWITSA-N |
| XLogP | 4.97 |
| TPSA | 83.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|