C31H48O6Si — CID 139249779
(4S,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methoxy]-2-methyl-7-(phenylmethoxymethoxy)octanal (PubChem CID 139249779) has the molecular formula C31H48O6Si and a molecular weight of 544.81 g/mol. Its IUPAC name is (4S,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methoxy]-2-methyl-7-(phenylmethoxymethoxy)octanal.
| Compound Name | (4S,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methoxy]-2-methyl-7-(phenylmethoxymethoxy)octanal |
|---|---|
| PubChem CID | 139249779 |
| Molecular Formula | C31H48O6Si |
| Molecular Weight | 544.81 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | (4S,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methoxy]-2-methyl-7-(phenylmethoxymethoxy)octanal |
| SMILES | COc1ccc(CO[C@H](C[C@H](CC(C)C=O)O[Si](C)(C)C(C)(C)C)[C@@H](C)OCOCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H48O6Si/c1-24(20-32)18-29(37-38(7,8)31(3,4)5)19-30(35-22-27-14-16-28(33-6)17-15-27)25(2)36-23-34-21-26-12-10-9-11-13-26/h9-17,20,24-25,29-30H,18-19,21-23H2,1-8H3/t24?,25-,29+,30-/m1/s1 |
| InChIKey | RPZNTSLLUROXRH-DHDWOPIUSA-N |
| XLogP | 7.17 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.81 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|