C33H52O5Si — CID 11318925
(4S,7R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-7,9-dimethyl-10-phenylmethoxydecan-2-one (PubChem CID 11318925) has the molecular formula C33H52O5Si and a molecular weight of 556.86 g/mol. Its IUPAC name is (4S,7R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-7,9-dimethyl-10-phenylmethoxydecan-2-one.
| Compound Name | (4S,7R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-7,9-dimethyl-10-phenylmethoxydecan-2-one |
|---|---|
| PubChem CID | 11318925 |
| Molecular Formula | C33H52O5Si |
| Molecular Weight | 556.86 g/mol |
| Exact Mass | 556.36 |
| IUPAC Name | (4S,7R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-7,9-dimethyl-10-phenylmethoxydecan-2-one |
| SMILES | COc1ccc(CO[C@@H](CC[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)COCc2ccccc2)CC(C)=O)cc1 |
| InChI | InChI=1S/C33H52O5Si/c1-25(15-18-31(21-27(3)34)37-24-29-16-19-30(35-7)20-17-29)32(38-39(8,9)33(4,5)6)26(2)22-36-23-28-13-11-10-12-14-28/h10-14,16-17,19-20,25-26,31-32H,15,18,21-24H2,1-9H3/t25-,26-,31+,32+/m1/s1 |
| InChIKey | IWLRLWOWWAUYNK-BYMHMWHSSA-N |
| XLogP | 8.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.86 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|