C29H56O5Si2 — CID 71469752
(3S,4S,5R,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[(4-methoxyphenyl)methoxy]-5-methyloctan-2-ol (PubChem CID 71469752) has the molecular formula C29H56O5Si2 and a molecular weight of 540.93 g/mol. Its IUPAC name is (3S,4S,5R,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[(4-methoxyphenyl)methoxy]-5-methyloctan-2-ol.
| Compound Name | (3S,4S,5R,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[(4-methoxyphenyl)methoxy]-5-methyloctan-2-ol |
|---|---|
| PubChem CID | 71469752 |
| Molecular Formula | C29H56O5Si2 |
| Molecular Weight | 540.93 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | (3S,4S,5R,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[(4-methoxyphenyl)methoxy]-5-methyloctan-2-ol |
| SMILES | COc1ccc(CO[C@@H](C)C[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)O)cc1 |
| InChI | InChI=1S/C29H56O5Si2/c1-21(19-22(2)32-20-24-15-17-25(31-10)18-16-24)26(33-35(11,12)28(4,5)6)27(23(3)30)34-36(13,14)29(7,8)9/h15-18,21-23,26-27,30H,19-20H2,1-14H3/t21-,22+,23?,26+,27+/m1/s1 |
| InChIKey | VUIBDCIOZIIPDC-XPNXVIGOSA-N |
| XLogP | 7.79 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.93 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|