C25H42O3Si — CID 25228674
tert-butyl-[(3R,5S,6S)-3-[(4-methoxyphenyl)methoxy]-6-methyldec-9-yn-5-yl]oxy-dimethylsilane (PubChem CID 25228674) has the molecular formula C25H42O3Si and a molecular weight of 418.69 g/mol. Its IUPAC name is tert-butyl-[(3R,5S,6S)-3-[(4-methoxyphenyl)methoxy]-6-methyldec-9-yn-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,5S,6S)-3-[(4-methoxyphenyl)methoxy]-6-methyldec-9-yn-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 25228674 |
| Molecular Formula | C25H42O3Si |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | tert-butyl-[(3R,5S,6S)-3-[(4-methoxyphenyl)methoxy]-6-methyldec-9-yn-5-yl]oxy-dimethylsilane |
| SMILES | C#CCC[C@H](C)[C@H](C[C@@H](CC)OCc1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H42O3Si/c1-10-12-13-20(3)24(28-29(8,9)25(4,5)6)18-22(11-2)27-19-21-14-16-23(26-7)17-15-21/h1,14-17,20,22,24H,11-13,18-19H2,2-9H3/t20-,22+,24-/m0/s1 |
| InChIKey | YTKOAUXAIRONDR-FJIJXJHWSA-N |
| XLogP | 6.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|