C32H60O4Si2 — CID 11505055
tert-butyl-[(4S,7R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-[(4-methoxyphenyl)methoxy]dodec-1-en-4-yl]oxy-dimethylsilane (PubChem CID 11505055) has the molecular formula C32H60O4Si2 and a molecular weight of 565.00 g/mol. Its IUPAC name is tert-butyl-[(4S,7R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-[(4-methoxyphenyl)methoxy]dodec-1-en-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4S,7R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-[(4-methoxyphenyl)methoxy]dodec-1-en-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11505055 |
| Molecular Formula | C32H60O4Si2 |
| Molecular Weight | 565.00 g/mol |
| Exact Mass | 564.40 |
| IUPAC Name | tert-butyl-[(4S,7R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-[(4-methoxyphenyl)methoxy]dodec-1-en-4-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@H](CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCCC)OCc1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H60O4Si2/c1-14-16-18-29(34-25-26-19-21-27(33-9)22-20-26)30(36-38(12,13)32(6,7)8)24-23-28(17-15-2)35-37(10,11)31(3,4)5/h15,19-22,28-30H,2,14,16-18,23-25H2,1,3-13H3/t28-,29-,30-/m1/s1 |
| InChIKey | FJMYJHGXHSWWIU-IDZRBWSNSA-N |
| XLogP | 9.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.00 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|