C30H56O5Si2 — CID 53309488
(E,5S,6S,8R)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4-methoxyphenyl)methoxy]-8-methylnon-2-en-1-ol (PubChem CID 53309488) has the molecular formula C30H56O5Si2 and a molecular weight of 552.95 g/mol. Its IUPAC name is (E,5S,6S,8R)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4-methoxyphenyl)methoxy]-8-methylnon-2-en-1-ol.
| Compound Name | (E,5S,6S,8R)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4-methoxyphenyl)methoxy]-8-methylnon-2-en-1-ol |
|---|---|
| PubChem CID | 53309488 |
| Molecular Formula | C30H56O5Si2 |
| Molecular Weight | 552.95 g/mol |
| Exact Mass | 552.37 |
| IUPAC Name | (E,5S,6S,8R)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4-methoxyphenyl)methoxy]-8-methylnon-2-en-1-ol |
| SMILES | COc1ccc(CO[C@@H](C/C=C/CO)[C@H](C[C@@H](C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H56O5Si2/c1-24(22-34-36(9,10)29(2,3)4)21-28(35-37(11,12)30(5,6)7)27(15-13-14-20-31)33-23-25-16-18-26(32-8)19-17-25/h13-14,16-19,24,27-28,31H,15,20-23H2,1-12H3/b14-13+/t24-,27+,28+/m1/s1 |
| InChIKey | JGZICLLHVUMPPP-TUPMAURVSA-N |
| XLogP | 7.96 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.95 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|