C28H52O4Si2 — CID 11827311
tert-butyl-[(Z,1R,2R,3S,4R)-1-ethyl-3-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-5-trimethylsilyloxyhept-5-enoxy]-dimethylsilane (PubChem CID 11827311) has the molecular formula C28H52O4Si2 and a molecular weight of 508.89 g/mol. Its IUPAC name is tert-butyl-[(Z,1R,2R,3S,4R)-1-ethyl-3-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-5-trimethylsilyloxyhept-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z,1R,2R,3S,4R)-1-ethyl-3-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-5-trimethylsilyloxyhept-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11827311 |
| Molecular Formula | C28H52O4Si2 |
| Molecular Weight | 508.89 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | tert-butyl-[(Z,1R,2R,3S,4R)-1-ethyl-3-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-5-trimethylsilyloxyhept-5-enoxy]-dimethylsilane |
| SMILES | C/C=C(\O[Si](C)(C)C)[C@H](C)[C@@H](OCc1ccc(OC)cc1)[C@@H](C)[C@@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H52O4Si2/c1-14-25(31-33(9,10)11)21(3)27(30-20-23-16-18-24(29-8)19-17-23)22(4)26(15-2)32-34(12,13)28(5,6)7/h14,16-19,21-22,26-27H,15,20H2,1-13H3/b25-14-/t21-,22-,26+,27+/m0/s1 |
| InChIKey | SQKLWHQUJLBFOC-OUAUKLEJSA-N |
| XLogP | 8.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.89 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|