C32H51NO7Si — CID 101199274
(2S,3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-3,6-bis[(4-methoxyphenyl)methoxy]-N,2,4-trimethylhexanamide (PubChem CID 101199274) has the molecular formula C32H51NO7Si and a molecular weight of 589.85 g/mol. Its IUPAC name is (2S,3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-3,6-bis[(4-methoxyphenyl)methoxy]-N,2,4-trimethylhexanamide.
| Compound Name | (2S,3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-3,6-bis[(4-methoxyphenyl)methoxy]-N,2,4-trimethylhexanamide |
|---|---|
| PubChem CID | 101199274 |
| Molecular Formula | C32H51NO7Si |
| Molecular Weight | 589.85 g/mol |
| Exact Mass | 589.34 |
| IUPAC Name | (2S,3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-3,6-bis[(4-methoxyphenyl)methoxy]-N,2,4-trimethylhexanamide |
| SMILES | COc1ccc(COC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](OCc2ccc(OC)cc2)[C@H](C)C(=O)N(C)OC)cc1 |
| InChI | InChI=1S/C32H51NO7Si/c1-23(30(24(2)31(34)33(6)37-9)39-21-26-14-18-28(36-8)19-15-26)29(40-41(10,11)32(3,4)5)22-38-20-25-12-16-27(35-7)17-13-25/h12-19,23-24,29-30H,20-22H2,1-11H3/t23-,24-,29+,30-/m0/s1 |
| InChIKey | WRTIJAVRXHIORO-FCLIQBFMSA-N |
| XLogP | 6.49 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.85 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|