C31H41NO6Si — CID 156782553
(2R,3S,4R)-N-methoxy-N-methyl-2,3,5-tris(phenylmethoxy)-4-trimethylsilyloxypentanamide (PubChem CID 156782553) has the molecular formula C31H41NO6Si and a molecular weight of 551.76 g/mol. Its IUPAC name is (2R,3S,4R)-N-methoxy-N-methyl-2,3,5-tris(phenylmethoxy)-4-trimethylsilyloxypentanamide.
| Compound Name | (2R,3S,4R)-N-methoxy-N-methyl-2,3,5-tris(phenylmethoxy)-4-trimethylsilyloxypentanamide |
|---|---|
| PubChem CID | 156782553 |
| Molecular Formula | C31H41NO6Si |
| Molecular Weight | 551.76 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | (2R,3S,4R)-N-methoxy-N-methyl-2,3,5-tris(phenylmethoxy)-4-trimethylsilyloxypentanamide |
| SMILES | CON(C)C(=O)[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C31H41NO6Si/c1-32(34-2)31(33)30(37-23-27-19-13-8-14-20-27)29(36-22-26-17-11-7-12-18-26)28(38-39(3,4)5)24-35-21-25-15-9-6-10-16-25/h6-20,28-30H,21-24H2,1-5H3/t28-,29-,30-/m1/s1 |
| InChIKey | MCJMYSAWPVJYEE-IDZRBWSNSA-N |
| XLogP | 5.61 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.76 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|