C45H53N3O6 — CID 22874999
2,3-diamino-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentakis(phenylmethoxy)hexyl]propanamide (PubChem CID 22874999) has the molecular formula C45H53N3O6 and a molecular weight of 731.93 g/mol. Its IUPAC name is 2,3-diamino-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentakis(phenylmethoxy)hexyl]propanamide.
| Compound Name | 2,3-diamino-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentakis(phenylmethoxy)hexyl]propanamide |
|---|---|
| PubChem CID | 22874999 |
| Molecular Formula | C45H53N3O6 |
| Molecular Weight | 731.93 g/mol |
| Exact Mass | 731.39 |
| IUPAC Name | 2,3-diamino-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentakis(phenylmethoxy)hexyl]propanamide |
| SMILES | CN(C[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OCc1ccccc1)C(=O)C(N)CN |
| InChI | InChI=1S/C45H53N3O6/c1-48(45(49)40(47)27-46)28-41(51-30-36-19-9-3-10-20-36)43(53-32-38-23-13-5-14-24-38)44(54-33-39-25-15-6-16-26-39)42(52-31-37-21-11-4-12-22-37)34-50-29-35-17-7-2-8-18-35/h2-26,40-44H,27-34,46-47H2,1H3/t40?,41-,42+,43+,44+/m0/s1 |
| InChIKey | ZKKXLXAWXCTZAW-JMYGFSEDSA-N |
| XLogP | 6.29 |
| TPSA | 118.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.93 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |