C34H36O6 — CID 177394840
[(2S,3R,4S)-1,3,4,5-tetrakis(phenylmethoxy)pentan-2-yl] formate (PubChem CID 177394840) has the molecular formula C34H36O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is [(2S,3R,4S)-1,3,4,5-tetrakis(phenylmethoxy)pentan-2-yl] formate.
| Compound Name | [(2S,3R,4S)-1,3,4,5-tetrakis(phenylmethoxy)pentan-2-yl] formate |
|---|---|
| PubChem CID | 177394840 |
| Molecular Formula | C34H36O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | [(2S,3R,4S)-1,3,4,5-tetrakis(phenylmethoxy)pentan-2-yl] formate |
| SMILES | O=CO[C@@H](COCc1ccccc1)[C@H](OCc1ccccc1)[C@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C34H36O6/c35-27-40-33(26-37-22-29-15-7-2-8-16-29)34(39-24-31-19-11-4-12-20-31)32(38-23-30-17-9-3-10-18-30)25-36-21-28-13-5-1-6-14-28/h1-20,27,32-34H,21-26H2/t32-,33-,34+/m0/s1 |
| InChIKey | RNJLLSWHMAZBFN-DHWXLLNHSA-N |
| XLogP | 6.13 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|