C29H35O9P — CID 11071783
[(2R,3R,4S)-5-dimethoxyphosphoryl-5-hydroxy-1,3,4-tris(phenylmethoxy)pentan-2-yl] formate (PubChem CID 11071783) has the molecular formula C29H35O9P and a molecular weight of 558.56 g/mol. Its IUPAC name is [(2R,3R,4S)-5-dimethoxyphosphoryl-5-hydroxy-1,3,4-tris(phenylmethoxy)pentan-2-yl] formate.
| Compound Name | [(2R,3R,4S)-5-dimethoxyphosphoryl-5-hydroxy-1,3,4-tris(phenylmethoxy)pentan-2-yl] formate |
|---|---|
| PubChem CID | 11071783 |
| Molecular Formula | C29H35O9P |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | [(2R,3R,4S)-5-dimethoxyphosphoryl-5-hydroxy-1,3,4-tris(phenylmethoxy)pentan-2-yl] formate |
| SMILES | COP(=O)(OC)C(O)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OC=O |
| InChI | InChI=1S/C29H35O9P/c1-33-39(32,34-2)29(31)28(37-20-25-16-10-5-11-17-25)27(36-19-24-14-8-4-9-15-24)26(38-22-30)21-35-18-23-12-6-3-7-13-23/h3-17,22,26-29,31H,18-21H2,1-2H3/t26-,27-,28+,29?/m1/s1 |
| InChIKey | OAWSYQMLPAZIHV-HFVNIMEJSA-N |
| XLogP | 4.72 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|