C32H31O5P — CID 102448049
[(2R,3S)-4-diphenylphosphoryl-1,3-bis(phenylmethoxy)pent-4-en-2-yl] formate (PubChem CID 102448049) has the molecular formula C32H31O5P and a molecular weight of 526.57 g/mol. Its IUPAC name is [(2R,3S)-4-diphenylphosphoryl-1,3-bis(phenylmethoxy)pent-4-en-2-yl] formate.
| Compound Name | [(2R,3S)-4-diphenylphosphoryl-1,3-bis(phenylmethoxy)pent-4-en-2-yl] formate |
|---|---|
| PubChem CID | 102448049 |
| Molecular Formula | C32H31O5P |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | [(2R,3S)-4-diphenylphosphoryl-1,3-bis(phenylmethoxy)pent-4-en-2-yl] formate |
| SMILES | C=C([C@@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OC=O)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H31O5P/c1-26(38(34,29-18-10-4-11-19-29)30-20-12-5-13-21-30)32(36-23-28-16-8-3-9-17-28)31(37-25-33)24-35-22-27-14-6-2-7-15-27/h2-21,25,31-32H,1,22-24H2/t31-,32-/m1/s1 |
| InChIKey | XEDCHXAPEPMIMW-ROJLCIKYSA-N |
| XLogP | 5.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|