C32H35NO4 — CID 12964018
N-benzyl-N-[(2S,3S)-1,3,4-tris(phenylmethoxy)butan-2-yl]hydroxylamine (PubChem CID 12964018) has the molecular formula C32H35NO4 and a molecular weight of 497.64 g/mol. Its IUPAC name is N-benzyl-N-[(2S,3S)-1,3,4-tris(phenylmethoxy)butan-2-yl]hydroxylamine.
| Compound Name | N-benzyl-N-[(2S,3S)-1,3,4-tris(phenylmethoxy)butan-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 12964018 |
| Molecular Formula | C32H35NO4 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | N-benzyl-N-[(2S,3S)-1,3,4-tris(phenylmethoxy)butan-2-yl]hydroxylamine |
| SMILES | ON(Cc1ccccc1)[C@@H](COCc1ccccc1)[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C32H35NO4/c34-33(21-27-13-5-1-6-14-27)31(25-35-22-28-15-7-2-8-16-28)32(37-24-30-19-11-4-12-20-30)26-36-23-29-17-9-3-10-18-29/h1-20,31-32,34H,21-26H2/t31-,32+/m0/s1 |
| InChIKey | ODNRAZYMNNVNDM-AJQTZOPKSA-N |
| XLogP | 6.27 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|