C18H20N2O2 — CID 142485430
(3S)-2-amino-3,4-bis(phenylmethoxy)butanenitrile (PubChem CID 142485430) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (3S)-2-amino-3,4-bis(phenylmethoxy)butanenitrile.
| Compound Name | (3S)-2-amino-3,4-bis(phenylmethoxy)butanenitrile |
|---|---|
| PubChem CID | 142485430 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (3S)-2-amino-3,4-bis(phenylmethoxy)butanenitrile |
| SMILES | N#CC(N)[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C18H20N2O2/c19-11-17(20)18(22-13-16-9-5-2-6-10-16)14-21-12-15-7-3-1-4-8-15/h1-10,17-18H,12-14,20H2/t17?,18-/m1/s1 |
| InChIKey | RMAXTAJMFAIXOQ-QRWMCTBCSA-N |
| XLogP | 2.64 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |