About (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile
(2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile (PubChem CID 11825219) has the molecular formula C25H26N2O2
and a molecular weight of 386.50 g/mol. Its IUPAC name is (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile.
Molecular Properties
| Compound Name | (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile |
| PubChem CID | 11825219 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile |
| SMILES | N#C[C@@H](NCc1ccccc1)[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C25H26N2O2/c26-16-24(27-17-21-10-4-1-5-11-21)25(29-19-23-14-8-3-9-15-23)20-28-18-22-12-6-2-7-13-22/h1-15,24-25,27H,17-20H2/t24-,25-/m1/s1 |
| InChIKey | SYXBGASMGLZGCK-JWQCQUIFSA-N |
| XLogP | 4.47 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile?
The IUPAC name of (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile (CID 11825219) is (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile.
What is the SMILES notation for (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile?
The canonical SMILES for (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile is N#C[C@@H](NCc1ccccc1)[C@@H](COCc1ccccc1)OCc1ccccc1.
What is the InChIKey of (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile?
The InChIKey is SYXBGASMGLZGCK-JWQCQUIFSA-N. The full InChI is InChI=1S/C25H26N2O2/c26-16-24(27-17-21-10-4-1-5-11-21)25(29-19-23-14-8-3-9-15-23)20-28-18-22-12-6-2-7-13-22/h1-15,24-25,27H,17-20H2/t24-,25-/m1/s1.
What are the key properties of (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile?
(2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile has a molecular weight of 386.50 g/mol, XLogP of 4.47, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile is sourced from PubChem (CID 11825219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).