C25H26N2O2 — CID 11825219
(2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile (PubChem CID 11825219) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile.
| Compound Name | (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile |
|---|---|
| PubChem CID | 11825219 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (2R,3S)-2-(benzylamino)-3,4-bis(phenylmethoxy)butanenitrile |
| SMILES | N#C[C@@H](NCc1ccccc1)[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C25H26N2O2/c26-16-24(27-17-21-10-4-1-5-11-21)25(29-19-23-14-8-3-9-15-23)20-28-18-22-12-6-2-7-13-22/h1-15,24-25,27H,17-20H2/t24-,25-/m1/s1 |
| InChIKey | SYXBGASMGLZGCK-JWQCQUIFSA-N |
| XLogP | 4.47 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |