C27H31NO2 — CID 101218139
(2S,3S)-N-benzyl-1,2-bis(phenylmethoxy)hex-5-en-3-amine (PubChem CID 101218139) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is (2S,3S)-N-benzyl-1,2-bis(phenylmethoxy)hex-5-en-3-amine.
| Compound Name | (2S,3S)-N-benzyl-1,2-bis(phenylmethoxy)hex-5-en-3-amine |
|---|---|
| PubChem CID | 101218139 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (2S,3S)-N-benzyl-1,2-bis(phenylmethoxy)hex-5-en-3-amine |
| SMILES | C=CC[C@H](NCc1ccccc1)[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C27H31NO2/c1-2-12-26(28-19-23-13-6-3-7-14-23)27(30-21-25-17-10-5-11-18-25)22-29-20-24-15-8-4-9-16-24/h2-11,13-18,26-28H,1,12,19-22H2/t26-,27+/m0/s1 |
| InChIKey | JQKXDFVZRJRTRR-RRPNLBNLSA-N |
| XLogP | 5.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|