C29H34O3 — CID 165415773
[(2R,3S)-4,4-dimethyl-2,3-bis(phenylmethoxy)hex-5-enoxy]methylbenzene (PubChem CID 165415773) has the molecular formula C29H34O3 and a molecular weight of 430.59 g/mol. Its IUPAC name is [(2R,3S)-4,4-dimethyl-2,3-bis(phenylmethoxy)hex-5-enoxy]methylbenzene.
| Compound Name | [(2R,3S)-4,4-dimethyl-2,3-bis(phenylmethoxy)hex-5-enoxy]methylbenzene |
|---|---|
| PubChem CID | 165415773 |
| Molecular Formula | C29H34O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | [(2R,3S)-4,4-dimethyl-2,3-bis(phenylmethoxy)hex-5-enoxy]methylbenzene |
| SMILES | C=CC(C)(C)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C29H34O3/c1-4-29(2,3)28(32-22-26-18-12-7-13-19-26)27(31-21-25-16-10-6-11-17-25)23-30-20-24-14-8-5-9-15-24/h4-19,27-28H,1,20-23H2,2-3H3/t27-,28-/m1/s1 |
| InChIKey | LJAMNBGALMNMET-VSGBNLITSA-N |
| XLogP | 6.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|