C24H32O6 — CID 122213469
[(2S,3S,4R)-2,3-bis(methoxymethoxy)-4-phenylmethoxyhex-5-enoxy]methylbenzene (PubChem CID 122213469) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is [(2S,3S,4R)-2,3-bis(methoxymethoxy)-4-phenylmethoxyhex-5-enoxy]methylbenzene.
| Compound Name | [(2S,3S,4R)-2,3-bis(methoxymethoxy)-4-phenylmethoxyhex-5-enoxy]methylbenzene |
|---|---|
| PubChem CID | 122213469 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [(2S,3S,4R)-2,3-bis(methoxymethoxy)-4-phenylmethoxyhex-5-enoxy]methylbenzene |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@H](OCOC)[C@H](COCc1ccccc1)OCOC |
| InChI | InChI=1S/C24H32O6/c1-4-22(28-16-21-13-9-6-10-14-21)24(30-19-26-3)23(29-18-25-2)17-27-15-20-11-7-5-8-12-20/h4-14,22-24H,1,15-19H2,2-3H3/t22-,23+,24+/m1/s1 |
| InChIKey | KYFQNVJJZVXFKV-SGNDLWITSA-N |
| XLogP | 3.95 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|