C29H34O5 — CID 135036465
[(E,2R,3S)-2-(methoxymethoxy)-3,6-bis(phenylmethoxy)hex-4-enoxy]methylbenzene (PubChem CID 135036465) has the molecular formula C29H34O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is [(E,2R,3S)-2-(methoxymethoxy)-3,6-bis(phenylmethoxy)hex-4-enoxy]methylbenzene.
| Compound Name | [(E,2R,3S)-2-(methoxymethoxy)-3,6-bis(phenylmethoxy)hex-4-enoxy]methylbenzene |
|---|---|
| PubChem CID | 135036465 |
| Molecular Formula | C29H34O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | [(E,2R,3S)-2-(methoxymethoxy)-3,6-bis(phenylmethoxy)hex-4-enoxy]methylbenzene |
| SMILES | COCO[C@H](COCc1ccccc1)[C@H](/C=C/COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C29H34O5/c1-30-24-34-29(23-32-21-26-14-7-3-8-15-26)28(33-22-27-16-9-4-10-17-27)18-11-19-31-20-25-12-5-2-6-13-25/h2-18,28-29H,19-24H2,1H3/b18-11+/t28-,29+/m0/s1 |
| InChIKey | ZXXRDWUOJJMFIU-JOPXZMSXSA-N |
| XLogP | 5.55 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|