C25H34O7 — CID 90855884
(4S)-4,6-bis(methoxymethoxy)-5,7-bis(phenylmethoxy)hept-2-en-1-ol (PubChem CID 90855884) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is (4S)-4,6-bis(methoxymethoxy)-5,7-bis(phenylmethoxy)hept-2-en-1-ol.
| Compound Name | (4S)-4,6-bis(methoxymethoxy)-5,7-bis(phenylmethoxy)hept-2-en-1-ol |
|---|---|
| PubChem CID | 90855884 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | (4S)-4,6-bis(methoxymethoxy)-5,7-bis(phenylmethoxy)hept-2-en-1-ol |
| SMILES | COCOC(COCc1ccccc1)C(OCc1ccccc1)[C@H](C=CCO)OCOC |
| InChI | InChI=1S/C25H34O7/c1-27-19-31-23(14-9-15-26)25(30-17-22-12-7-4-8-13-22)24(32-20-28-2)18-29-16-21-10-5-3-6-11-21/h3-14,23-26H,15-20H2,1-2H3/t23-,24?,25?/m0/s1 |
| InChIKey | DYWACKAFLZUCQD-KAVZGVEFSA-N |
| XLogP | 3.32 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|