C14H20O3 — CID 11806633
(E,4R)-4-methyl-5-(phenylmethoxymethoxy)pent-2-en-1-ol (PubChem CID 11806633) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (E,4R)-4-methyl-5-(phenylmethoxymethoxy)pent-2-en-1-ol.
| Compound Name | (E,4R)-4-methyl-5-(phenylmethoxymethoxy)pent-2-en-1-ol |
|---|---|
| PubChem CID | 11806633 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (E,4R)-4-methyl-5-(phenylmethoxymethoxy)pent-2-en-1-ol |
| SMILES | C[C@H](/C=C/CO)COCOCc1ccccc1 |
| InChI | InChI=1S/C14H20O3/c1-13(6-5-9-15)10-16-12-17-11-14-7-3-2-4-8-14/h2-8,13,15H,9-12H2,1H3/b6-5+/t13-/m1/s1 |
| InChIKey | IXRBVFKCIGHZGV-URWSZGRFSA-N |
| XLogP | 2.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|