C15H22O3 — CID 11139553
(2S,4R)-2,4-dimethyl-5-(phenylmethoxymethoxy)pentanal (PubChem CID 11139553) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2S,4R)-2,4-dimethyl-5-(phenylmethoxymethoxy)pentanal.
| Compound Name | (2S,4R)-2,4-dimethyl-5-(phenylmethoxymethoxy)pentanal |
|---|---|
| PubChem CID | 11139553 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2S,4R)-2,4-dimethyl-5-(phenylmethoxymethoxy)pentanal |
| SMILES | C[C@@H](COCOCc1ccccc1)C[C@H](C)C=O |
| InChI | InChI=1S/C15H22O3/c1-13(9-16)8-14(2)10-17-12-18-11-15-6-4-3-5-7-15/h3-7,9,13-14H,8,10-12H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | IZQUXKYDDBEYJW-UONOGXRCSA-N |
| XLogP | 3.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|