C17H28O2 — CID 134854729
(2S,4R,6S)-2,4,6-trimethyl-7-phenylmethoxyheptan-1-ol (PubChem CID 134854729) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (2S,4R,6S)-2,4,6-trimethyl-7-phenylmethoxyheptan-1-ol.
| Compound Name | (2S,4R,6S)-2,4,6-trimethyl-7-phenylmethoxyheptan-1-ol |
|---|---|
| PubChem CID | 134854729 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (2S,4R,6S)-2,4,6-trimethyl-7-phenylmethoxyheptan-1-ol |
| SMILES | C[C@H](C[C@H](C)CO)C[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C17H28O2/c1-14(9-15(2)11-18)10-16(3)12-19-13-17-7-5-4-6-8-17/h4-8,14-16,18H,9-13H2,1-3H3/t14-,15+,16+/m1/s1 |
| InChIKey | HUYBAOOTAWWICK-PMPSAXMXSA-N |
| XLogP | 3.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |