C18H30O3 — CID 71079760
(2R,4S)-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptan-1-ol (PubChem CID 71079760) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (2R,4S)-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptan-1-ol.
| Compound Name | (2R,4S)-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptan-1-ol |
|---|---|
| PubChem CID | 71079760 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (2R,4S)-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptan-1-ol |
| SMILES | COc1ccc(COCC(C)C[C@@H](C)C[C@@H](C)CO)cc1 |
| InChI | InChI=1S/C18H30O3/c1-14(9-15(2)11-19)10-16(3)12-21-13-17-5-7-18(20-4)8-6-17/h5-8,14-16,19H,9-13H2,1-4H3/t14-,15+,16?/m0/s1 |
| InChIKey | PHFVOTZQVLITQF-QMRHZFGWSA-N |
| XLogP | 3.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |