C24H44O4Si — CID 69022764
(2R,4S,5R,6S)-5-[butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptan-1-ol (PubChem CID 69022764) has the molecular formula C24H44O4Si and a molecular weight of 424.70 g/mol. Its IUPAC name is (2R,4S,5R,6S)-5-[butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptan-1-ol.
| Compound Name | (2R,4S,5R,6S)-5-[butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptan-1-ol |
|---|---|
| PubChem CID | 69022764 |
| Molecular Formula | C24H44O4Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | (2R,4S,5R,6S)-5-[butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptan-1-ol |
| SMILES | CCCC[Si](C)(C)O[C@@H]([C@@H](C)COCc1ccc(OC)cc1)[C@@H](C)C[C@@H](C)CO |
| InChI | InChI=1S/C24H44O4Si/c1-8-9-14-29(6,7)28-24(20(3)15-19(2)16-25)21(4)17-27-18-22-10-12-23(26-5)13-11-22/h10-13,19-21,24-25H,8-9,14-18H2,1-7H3/t19-,20+,21+,24-/m1/s1 |
| InChIKey | WNCHNVGPPGPXKA-MDAIXWLXSA-N |
| XLogP | 5.89 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|