C21H36O4Si — CID 177467980
(2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanal (PubChem CID 177467980) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is (2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanal.
| Compound Name | (2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanal |
|---|---|
| PubChem CID | 177467980 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2,4-dimethylpentanal |
| SMILES | COc1ccc(COC[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C(C)C=O)cc1 |
| InChI | InChI=1S/C21H36O4Si/c1-16(13-22)20(25-26(7,8)21(3,4)5)17(2)14-24-15-18-9-11-19(23-6)12-10-18/h9-13,16-17,20H,14-15H2,1-8H3/t16?,17-,20-/m1/s1 |
| InChIKey | RPRVQQNBLDZTMO-HMEKMZBJSA-N |
| XLogP | 5.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|