C22H37IO3Si — CID 16732701
tert-butyl-[(Z,2S,3S,4S)-6-iodo-1-[(4-methoxyphenyl)methoxy]-2,4-dimethylhex-5-en-3-yl]oxy-dimethylsilane (PubChem CID 16732701) has the molecular formula C22H37IO3Si and a molecular weight of 504.53 g/mol. Its IUPAC name is tert-butyl-[(Z,2S,3S,4S)-6-iodo-1-[(4-methoxyphenyl)methoxy]-2,4-dimethylhex-5-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(Z,2S,3S,4S)-6-iodo-1-[(4-methoxyphenyl)methoxy]-2,4-dimethylhex-5-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 16732701 |
| Molecular Formula | C22H37IO3Si |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | tert-butyl-[(Z,2S,3S,4S)-6-iodo-1-[(4-methoxyphenyl)methoxy]-2,4-dimethylhex-5-en-3-yl]oxy-dimethylsilane |
| SMILES | COc1ccc(COC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C\I)cc1 |
| InChI | InChI=1S/C22H37IO3Si/c1-17(13-14-23)21(26-27(7,8)22(3,4)5)18(2)15-25-16-19-9-11-20(24-6)12-10-19/h9-14,17-18,21H,15-16H2,1-8H3/b14-13-/t17-,18-,21-/m0/s1 |
| InChIKey | KTHVDERQGCOPAQ-YJGVZCSDSA-N |
| XLogP | 6.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|