C36H48N2O8Si — CID 71623643
benzyl N-[(E,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxy-2-nitrophenyl)-6-[(4-methoxyphenyl)methoxy]-5-methylhex-1-en-3-yl]carbamate (PubChem CID 71623643) has the molecular formula C36H48N2O8Si and a molecular weight of 664.87 g/mol. Its IUPAC name is benzyl N-[(E,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxy-2-nitrophenyl)-6-[(4-methoxyphenyl)methoxy]-5-methylhex-1-en-3-yl]carbamate.
| Compound Name | benzyl N-[(E,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxy-2-nitrophenyl)-6-[(4-methoxyphenyl)methoxy]-5-methylhex-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 71623643 |
| Molecular Formula | C36H48N2O8Si |
| Molecular Weight | 664.87 g/mol |
| Exact Mass | 664.32 |
| IUPAC Name | benzyl N-[(E,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxy-2-nitrophenyl)-6-[(4-methoxyphenyl)methoxy]-5-methylhex-1-en-3-yl]carbamate |
| SMILES | COc1ccc(COC[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C/c2ccc(OC)cc2[N+](=O)[O-])NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H48N2O8Si/c1-26(23-44-24-28-14-18-30(42-5)19-15-28)34(46-47(7,8)36(2,3)4)32(37-35(39)45-25-27-12-10-9-11-13-27)21-17-29-16-20-31(43-6)22-33(29)38(40)41/h9-22,26,32,34H,23-25H2,1-8H3,(H,37,39)/b21-17+/t26-,32-,34-/m1/s1 |
| InChIKey | DUDGAZZSYOIBTH-GLPVCTONSA-N |
| XLogP | 8.16 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.87 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|