C35H58O7Si2 — CID 11273742
(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1,7-bis[(4-methoxyphenyl)methoxy]heptan-4-one (PubChem CID 11273742) has the molecular formula C35H58O7Si2 and a molecular weight of 647.01 g/mol. Its IUPAC name is (2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1,7-bis[(4-methoxyphenyl)methoxy]heptan-4-one.
| Compound Name | (2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1,7-bis[(4-methoxyphenyl)methoxy]heptan-4-one |
|---|---|
| PubChem CID | 11273742 |
| Molecular Formula | C35H58O7Si2 |
| Molecular Weight | 647.01 g/mol |
| Exact Mass | 646.37 |
| IUPAC Name | (2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1,7-bis[(4-methoxyphenyl)methoxy]heptan-4-one |
| SMILES | COc1ccc(COC[C@@H](CC(=O)C[C@H](COCc2ccc(OC)cc2)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C35H58O7Si2/c1-34(2,3)43(9,10)41-32(25-39-23-27-13-17-30(37-7)18-14-27)21-29(36)22-33(42-44(11,12)35(4,5)6)26-40-24-28-15-19-31(38-8)20-16-28/h13-20,32-33H,21-26H2,1-12H3/t32-,33-/m1/s1 |
| InChIKey | BLDXUPJBHJLWQK-CZNDPXEESA-N |
| XLogP | 8.57 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.01 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|