C18H30O4Si — CID 85424805
4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5-phenylmethoxypentan-2-one (PubChem CID 85424805) has the molecular formula C18H30O4Si and a molecular weight of 338.52 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5-phenylmethoxypentan-2-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5-phenylmethoxypentan-2-one |
|---|---|
| PubChem CID | 85424805 |
| Molecular Formula | C18H30O4Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5-phenylmethoxypentan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC(COCc1ccccc1)CC(=O)CO |
| InChI | InChI=1S/C18H30O4Si/c1-18(2,3)23(4,5)22-17(11-16(20)12-19)14-21-13-15-9-7-6-8-10-15/h6-10,17,19H,11-14H2,1-5H3 |
| InChIKey | JEYMWHXAIKZJDH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|