C21H35O7PSi — CID 57057471
benzyl 3-[tert-butyl(dimethyl)silyl]oxy-6-dimethoxyphosphoryl-5-oxohexanoate (PubChem CID 57057471) has the molecular formula C21H35O7PSi and a molecular weight of 458.56 g/mol. Its IUPAC name is benzyl 3-[tert-butyl(dimethyl)silyl]oxy-6-dimethoxyphosphoryl-5-oxohexanoate.
| Compound Name | benzyl 3-[tert-butyl(dimethyl)silyl]oxy-6-dimethoxyphosphoryl-5-oxohexanoate |
|---|---|
| PubChem CID | 57057471 |
| Molecular Formula | C21H35O7PSi |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | benzyl 3-[tert-butyl(dimethyl)silyl]oxy-6-dimethoxyphosphoryl-5-oxohexanoate |
| SMILES | COP(=O)(CC(=O)CC(CC(=O)OCc1ccccc1)O[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C21H35O7PSi/c1-21(2,3)30(6,7)28-19(13-18(22)16-29(24,25-4)26-5)14-20(23)27-15-17-11-9-8-10-12-17/h8-12,19H,13-16H2,1-7H3 |
| InChIKey | YXPCTHCXCJYGEE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|