C23H30O5Si — CID 68833938
3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-oxo-4-phenylmethoxybutanoic acid (PubChem CID 68833938) has the molecular formula C23H30O5Si and a molecular weight of 414.57 g/mol. Its IUPAC name is 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-oxo-4-phenylmethoxybutanoic acid.
| Compound Name | 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-oxo-4-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 68833938 |
| Molecular Formula | C23H30O5Si |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-oxo-4-phenylmethoxybutanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C(CC(=O)O)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H30O5Si/c1-23(2,3)29(4,5)28-19-13-11-18(12-14-19)20(15-21(24)25)22(26)27-16-17-9-7-6-8-10-17/h6-14,20H,15-16H2,1-5H3,(H,24,25) |
| InChIKey | KIFCUJFQJMLHCI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|