C22H30O3Si — CID 102575732
[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl 3-phenylpropanoate (PubChem CID 102575732) has the molecular formula C22H30O3Si and a molecular weight of 370.57 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl 3-phenylpropanoate.
| Compound Name | [4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl 3-phenylpropanoate |
|---|---|
| PubChem CID | 102575732 |
| Molecular Formula | C22H30O3Si |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl 3-phenylpropanoate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(COC(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H30O3Si/c1-22(2,3)26(4,5)25-20-14-11-19(12-15-20)17-24-21(23)16-13-18-9-7-6-8-10-18/h6-12,14-15H,13,16-17H2,1-5H3 |
| InChIKey | SBXCKZOMPMDHSX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|