C24H32O3Si — CID 89451937
benzyl 2-[4-[tert-butyl(dimethyl)silyl]oxy-2-cyclopropylphenyl]acetate (PubChem CID 89451937) has the molecular formula C24H32O3Si and a molecular weight of 396.60 g/mol. Its IUPAC name is benzyl 2-[4-[tert-butyl(dimethyl)silyl]oxy-2-cyclopropylphenyl]acetate.
| Compound Name | benzyl 2-[4-[tert-butyl(dimethyl)silyl]oxy-2-cyclopropylphenyl]acetate |
|---|---|
| PubChem CID | 89451937 |
| Molecular Formula | C24H32O3Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | benzyl 2-[4-[tert-butyl(dimethyl)silyl]oxy-2-cyclopropylphenyl]acetate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(CC(=O)OCc2ccccc2)c(C2CC2)c1 |
| InChI | InChI=1S/C24H32O3Si/c1-24(2,3)28(4,5)27-21-14-13-20(22(16-21)19-11-12-19)15-23(25)26-17-18-9-7-6-8-10-18/h6-10,13-14,16,19H,11-12,15,17H2,1-5H3 |
| InChIKey | PHLRFMKRWSOLBG-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|