C42H68O6Si2 — CID 160532130
benzyl 2-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetate (PubChem CID 160532130) has the molecular formula C42H68O6Si2 and a molecular weight of 725.17 g/mol. Its IUPAC name is benzyl 2-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetate.
| Compound Name | benzyl 2-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetate |
|---|---|
| PubChem CID | 160532130 |
| Molecular Formula | C42H68O6Si2 |
| Molecular Weight | 725.17 g/mol |
| Exact Mass | 724.46 |
| IUPAC Name | benzyl 2-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]acetate |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(CC(=O)OCc2ccccc2)CC1.CC(C)(C)[Si](C)(C)OC1CCC(CC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/2C21H34O3Si/c2*1-21(2,3)25(4,5)24-19-13-11-17(12-14-19)15-20(22)23-16-18-9-7-6-8-10-18/h2*6-10,17,19H,11-16H2,1-5H3 |
| InChIKey | QVRLMHLQPGDLIT-UHFFFAOYSA-N |
| XLogP | 11.40 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.17 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|